C29H29N3O3 — CID 130472091
6-(2-cyclopentylethyl)-2-(1,3,6-trimethyl-2-oxobenzimidazol-5-yl)benzo[de]isoquinoline-1,3-dione (PubChem CID 130472091) has the molecular formula C29H29N3O3 and a molecular weight of 467.57 g/mol. Its IUPAC name is 6-(2-cyclopentylethyl)-2-(1,3,6-trimethyl-2-oxobenzimidazol-5-yl)benzo[de]isoquinoline-1,3-dione.
| Compound Name | 6-(2-cyclopentylethyl)-2-(1,3,6-trimethyl-2-oxobenzimidazol-5-yl)benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 130472091 |
| Molecular Formula | C29H29N3O3 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | 6-(2-cyclopentylethyl)-2-(1,3,6-trimethyl-2-oxobenzimidazol-5-yl)benzo[de]isoquinoline-1,3-dione |
| SMILES | Cc1cc2c(cc1N1C(=O)c3cccc4c(CCC5CCCC5)ccc(c34)C1=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C29H29N3O3/c1-17-15-24-25(31(3)29(35)30(24)2)16-23(17)32-27(33)21-10-6-9-20-19(12-11-18-7-4-5-8-18)13-14-22(26(20)21)28(32)34/h6,9-10,13-16,18H,4-5,7-8,11-12H2,1-3H3 |
| InChIKey | BFWMIGQXTXRJPB-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 64.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|