C23H16ClFN2O3 — CID 2342263
2-chloro-N-[2-(1,3-dioxoisoindol-2-yl)ethyl]-N-(3-fluorophenyl)benzamide (PubChem CID 2342263) has the molecular formula C23H16ClFN2O3 and a molecular weight of 422.84 g/mol. Its IUPAC name is 2-chloro-N-[2-(1,3-dioxoisoindol-2-yl)ethyl]-N-(3-fluorophenyl)benzamide.
| Compound Name | 2-chloro-N-[2-(1,3-dioxoisoindol-2-yl)ethyl]-N-(3-fluorophenyl)benzamide |
|---|---|
| PubChem CID | 2342263 |
| Molecular Formula | C23H16ClFN2O3 |
| Molecular Weight | 422.84 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | 2-chloro-N-[2-(1,3-dioxoisoindol-2-yl)ethyl]-N-(3-fluorophenyl)benzamide |
| SMILES | O=C1c2ccccc2C(=O)N1CCN(C(=O)c1ccccc1Cl)c1cccc(F)c1 |
| InChI | InChI=1S/C23H16ClFN2O3/c24-20-11-4-3-10-19(20)23(30)26(16-7-5-6-15(25)14-16)12-13-27-21(28)17-8-1-2-9-18(17)22(27)29/h1-11,14H,12-13H2 |
| InChIKey | UPUJSBAZUHTXSD-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.84 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|