C25H19ClN2O5 — CID 3959049
ethyl 4-[(2-chlorobenzoyl)-[(1,3-dioxoisoindol-2-yl)methyl]amino]benzoate (PubChem CID 3959049) has the molecular formula C25H19ClN2O5 and a molecular weight of 462.89 g/mol. Its IUPAC name is ethyl 4-[(2-chlorobenzoyl)-[(1,3-dioxoisoindol-2-yl)methyl]amino]benzoate.
| Compound Name | ethyl 4-[(2-chlorobenzoyl)-[(1,3-dioxoisoindol-2-yl)methyl]amino]benzoate |
|---|---|
| PubChem CID | 3959049 |
| Molecular Formula | C25H19ClN2O5 |
| Molecular Weight | 462.89 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | ethyl 4-[(2-chlorobenzoyl)-[(1,3-dioxoisoindol-2-yl)methyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(N(CN2C(=O)c3ccccc3C2=O)C(=O)c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C25H19ClN2O5/c1-2-33-25(32)16-11-13-17(14-12-16)27(24(31)20-9-5-6-10-21(20)26)15-28-22(29)18-7-3-4-8-19(18)23(28)30/h3-14H,2,15H2,1H3 |
| InChIKey | IJZTYHWAVXKHQQ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.89 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|