C22H14BrFN2O3 — CID 4262657
N-(4-bromophenyl)-N-[(1,3-dioxoisoindol-2-yl)methyl]-2-fluorobenzamide (PubChem CID 4262657) has the molecular formula C22H14BrFN2O3 and a molecular weight of 453.27 g/mol. Its IUPAC name is N-(4-bromophenyl)-N-[(1,3-dioxoisoindol-2-yl)methyl]-2-fluorobenzamide.
| Compound Name | N-(4-bromophenyl)-N-[(1,3-dioxoisoindol-2-yl)methyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 4262657 |
| Molecular Formula | C22H14BrFN2O3 |
| Molecular Weight | 453.27 g/mol |
| Exact Mass | 452.02 |
| IUPAC Name | N-(4-bromophenyl)-N-[(1,3-dioxoisoindol-2-yl)methyl]-2-fluorobenzamide |
| SMILES | O=C1c2ccccc2C(=O)N1CN(C(=O)c1ccccc1F)c1ccc(Br)cc1 |
| InChI | InChI=1S/C22H14BrFN2O3/c23-14-9-11-15(12-10-14)25(22(29)18-7-3-4-8-19(18)24)13-26-20(27)16-5-1-2-6-17(16)21(26)28/h1-12H,13H2 |
| InChIKey | FTLKAIUFGTWOPE-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.27 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|