C17H10BrF3N2O3 — CID 1159357
N-(4-bromophenyl)-N-[(1,3-dioxoisoindol-2-yl)methyl]-2,2,2-trifluoroacetamide (PubChem CID 1159357) has the molecular formula C17H10BrF3N2O3 and a molecular weight of 427.18 g/mol. Its IUPAC name is N-(4-bromophenyl)-N-[(1,3-dioxoisoindol-2-yl)methyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-(4-bromophenyl)-N-[(1,3-dioxoisoindol-2-yl)methyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 1159357 |
| Molecular Formula | C17H10BrF3N2O3 |
| Molecular Weight | 427.18 g/mol |
| Exact Mass | 425.98 |
| IUPAC Name | N-(4-bromophenyl)-N-[(1,3-dioxoisoindol-2-yl)methyl]-2,2,2-trifluoroacetamide |
| SMILES | O=C1c2ccccc2C(=O)N1CN(C(=O)C(F)(F)F)c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H10BrF3N2O3/c18-10-5-7-11(8-6-10)22(16(26)17(19,20)21)9-23-14(24)12-3-1-2-4-13(12)15(23)25/h1-8H,9H2 |
| InChIKey | ZIYBTYFRGBHVPF-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.18 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|