C23H15F3N2O4 — CID 1159356
N-[(1,3-dioxoisoindol-2-yl)methyl]-2,2,2-trifluoro-N-(4-phenoxyphenyl)acetamide (PubChem CID 1159356) has the molecular formula C23H15F3N2O4 and a molecular weight of 440.38 g/mol. Its IUPAC name is N-[(1,3-dioxoisoindol-2-yl)methyl]-2,2,2-trifluoro-N-(4-phenoxyphenyl)acetamide.
| Compound Name | N-[(1,3-dioxoisoindol-2-yl)methyl]-2,2,2-trifluoro-N-(4-phenoxyphenyl)acetamide |
|---|---|
| PubChem CID | 1159356 |
| Molecular Formula | C23H15F3N2O4 |
| Molecular Weight | 440.38 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | N-[(1,3-dioxoisoindol-2-yl)methyl]-2,2,2-trifluoro-N-(4-phenoxyphenyl)acetamide |
| SMILES | O=C1c2ccccc2C(=O)N1CN(C(=O)C(F)(F)F)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C23H15F3N2O4/c24-23(25,26)22(31)27(14-28-20(29)18-8-4-5-9-19(18)21(28)30)15-10-12-17(13-11-15)32-16-6-2-1-3-7-16/h1-13H,14H2 |
| InChIKey | AJGKLSQAMDYZNJ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.38 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|