C19H13F3N2O4 — CID 1159351
N-(3-acetylphenyl)-N-[(1,3-dioxoisoindol-2-yl)methyl]-2,2,2-trifluoroacetamide (PubChem CID 1159351) has the molecular formula C19H13F3N2O4 and a molecular weight of 390.32 g/mol. Its IUPAC name is N-(3-acetylphenyl)-N-[(1,3-dioxoisoindol-2-yl)methyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-(3-acetylphenyl)-N-[(1,3-dioxoisoindol-2-yl)methyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 1159351 |
| Molecular Formula | C19H13F3N2O4 |
| Molecular Weight | 390.32 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | N-(3-acetylphenyl)-N-[(1,3-dioxoisoindol-2-yl)methyl]-2,2,2-trifluoroacetamide |
| SMILES | CC(=O)c1cccc(N(CN2C(=O)c3ccccc3C2=O)C(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C19H13F3N2O4/c1-11(25)12-5-4-6-13(9-12)23(18(28)19(20,21)22)10-24-16(26)14-7-2-3-8-15(14)17(24)27/h2-9H,10H2,1H3 |
| InChIKey | FAYCVSDIMOMSNK-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.32 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|