C20H16ClF3N2O3 — CID 100807998
N-(3-chlorophenyl)-N-[[(1R,2S,6R,7R,8S,10R)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]methyl]-2,2,2-trifluoroacetamide (PubChem CID 100807998) has the molecular formula C20H16ClF3N2O3 and a molecular weight of 424.81 g/mol. Its IUPAC name is N-(3-chlorophenyl)-N-[[(1R,2S,6R,7R,8S,10R)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]methyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-(3-chlorophenyl)-N-[[(1R,2S,6R,7R,8S,10R)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]methyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 100807998 |
| Molecular Formula | C20H16ClF3N2O3 |
| Molecular Weight | 424.81 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | N-(3-chlorophenyl)-N-[[(1R,2S,6R,7R,8S,10R)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]methyl]-2,2,2-trifluoroacetamide |
| SMILES | O=C1[C@@H]2[C@@H]3C=C[C@H]([C@@H]4C[C@H]34)[C@@H]2C(=O)N1CN(C(=O)C(F)(F)F)c1cccc(Cl)c1 |
| InChI | InChI=1S/C20H16ClF3N2O3/c21-9-2-1-3-10(6-9)25(19(29)20(22,23)24)8-26-17(27)15-11-4-5-12(14-7-13(11)14)16(15)18(26)28/h1-6,11-16H,7-8H2/t11-,12-,13-,14+,15-,16+/m1/s1 |
| InChIKey | PKABERWKDXAODB-FWXGHANASA-N |
| XLogP | 3.25 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.81 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|