C21H18ClF3N2O3 — CID 124712736
N-(3-chloro-4-methylphenyl)-N-[[(1S,2S,6R,7S,8S,10R)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]methyl]-2,2,2-trifluoroacetamide (PubChem CID 124712736) has the molecular formula C21H18ClF3N2O3 and a molecular weight of 438.83 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-N-[[(1S,2S,6R,7S,8S,10R)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]methyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-(3-chloro-4-methylphenyl)-N-[[(1S,2S,6R,7S,8S,10R)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]methyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 124712736 |
| Molecular Formula | C21H18ClF3N2O3 |
| Molecular Weight | 438.83 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-N-[[(1S,2S,6R,7S,8S,10R)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]methyl]-2,2,2-trifluoroacetamide |
| SMILES | Cc1ccc(N(CN2C(=O)[C@@H]3[C@H]4C=C[C@@H]([C@@H]5C[C@H]45)[C@@H]3C2=O)C(=O)C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C21H18ClF3N2O3/c1-9-2-3-10(6-15(9)22)26(20(30)21(23,24)25)8-27-18(28)16-11-4-5-12(14-7-13(11)14)17(16)19(27)29/h2-6,11-14,16-17H,7-8H2,1H3/t11-,12-,13-,14+,16-,17+/m0/s1 |
| InChIKey | BTNBWUOESNLRPD-PQTQVYOHSA-N |
| XLogP | 3.55 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.83 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|