C23H17BrN2O4 — CID 1070738
N-[(5-bromo-1,3-dioxoisoindol-2-yl)methyl]-N-(4-phenoxyphenyl)acetamide (PubChem CID 1070738) has the molecular formula C23H17BrN2O4 and a molecular weight of 465.30 g/mol. Its IUPAC name is N-[(5-bromo-1,3-dioxoisoindol-2-yl)methyl]-N-(4-phenoxyphenyl)acetamide.
| Compound Name | N-[(5-bromo-1,3-dioxoisoindol-2-yl)methyl]-N-(4-phenoxyphenyl)acetamide |
|---|---|
| PubChem CID | 1070738 |
| Molecular Formula | C23H17BrN2O4 |
| Molecular Weight | 465.30 g/mol |
| Exact Mass | 464.04 |
| IUPAC Name | N-[(5-bromo-1,3-dioxoisoindol-2-yl)methyl]-N-(4-phenoxyphenyl)acetamide |
| SMILES | CC(=O)N(CN1C(=O)c2ccc(Br)cc2C1=O)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C23H17BrN2O4/c1-15(27)25(14-26-22(28)20-12-7-16(24)13-21(20)23(26)29)17-8-10-19(11-9-17)30-18-5-3-2-4-6-18/h2-13H,14H2,1H3 |
| InChIKey | KDPWMSDXSLFDCQ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.30 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|