C22H13BrFN3O5 — CID 17385252
N-[(5-bromo-1,3-dioxoisoindol-2-yl)methyl]-N-(4-fluorophenyl)-4-nitrobenzamide (PubChem CID 17385252) has the molecular formula C22H13BrFN3O5 and a molecular weight of 498.26 g/mol. Its IUPAC name is N-[(5-bromo-1,3-dioxoisoindol-2-yl)methyl]-N-(4-fluorophenyl)-4-nitrobenzamide.
| Compound Name | N-[(5-bromo-1,3-dioxoisoindol-2-yl)methyl]-N-(4-fluorophenyl)-4-nitrobenzamide |
|---|---|
| PubChem CID | 17385252 |
| Molecular Formula | C22H13BrFN3O5 |
| Molecular Weight | 498.26 g/mol |
| Exact Mass | 497.00 |
| IUPAC Name | N-[(5-bromo-1,3-dioxoisoindol-2-yl)methyl]-N-(4-fluorophenyl)-4-nitrobenzamide |
| SMILES | O=C1c2ccc(Br)cc2C(=O)N1CN(C(=O)c1ccc([N+](=O)[O-])cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H13BrFN3O5/c23-14-3-10-18-19(11-14)22(30)26(21(18)29)12-25(16-8-4-15(24)5-9-16)20(28)13-1-6-17(7-2-13)27(31)32/h1-11H,12H2 |
| InChIKey | JWYKQIUVXGYXEN-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.26 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|