C18H12BrFN2O6 — CID 55375395
(5-fluoro-2-nitrophenyl) 4-(5-bromo-1,3-dioxoisoindol-2-yl)butanoate (PubChem CID 55375395) has the molecular formula C18H12BrFN2O6 and a molecular weight of 451.20 g/mol. Its IUPAC name is (5-fluoro-2-nitrophenyl) 4-(5-bromo-1,3-dioxoisoindol-2-yl)butanoate.
| Compound Name | (5-fluoro-2-nitrophenyl) 4-(5-bromo-1,3-dioxoisoindol-2-yl)butanoate |
|---|---|
| PubChem CID | 55375395 |
| Molecular Formula | C18H12BrFN2O6 |
| Molecular Weight | 451.20 g/mol |
| Exact Mass | 449.99 |
| IUPAC Name | (5-fluoro-2-nitrophenyl) 4-(5-bromo-1,3-dioxoisoindol-2-yl)butanoate |
| SMILES | O=C(CCCN1C(=O)c2ccc(Br)cc2C1=O)Oc1cc(F)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H12BrFN2O6/c19-10-3-5-12-13(8-10)18(25)21(17(12)24)7-1-2-16(23)28-15-9-11(20)4-6-14(15)22(26)27/h3-6,8-9H,1-2,7H2 |
| InChIKey | QVXMSXYGMWRVSU-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.20 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|