C20H14N2O4 — CID 4265825
N-[(1,3-dioxoisoindol-2-yl)methyl]-N-phenylfuran-2-carboxamide (PubChem CID 4265825) has the molecular formula C20H14N2O4 and a molecular weight of 346.34 g/mol. Its IUPAC name is N-[(1,3-dioxoisoindol-2-yl)methyl]-N-phenylfuran-2-carboxamide.
| Compound Name | N-[(1,3-dioxoisoindol-2-yl)methyl]-N-phenylfuran-2-carboxamide |
|---|---|
| PubChem CID | 4265825 |
| Molecular Formula | C20H14N2O4 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | N-[(1,3-dioxoisoindol-2-yl)methyl]-N-phenylfuran-2-carboxamide |
| SMILES | O=C1c2ccccc2C(=O)N1CN(C(=O)c1ccco1)c1ccccc1 |
| InChI | InChI=1S/C20H14N2O4/c23-18-15-9-4-5-10-16(15)19(24)22(18)13-21(14-7-2-1-3-8-14)20(25)17-11-6-12-26-17/h1-12H,13H2 |
| InChIKey | AUZJESHQIHDFHH-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|