C20H17FN2O4 — CID 7279741
N-[[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]methyl]-N-(4-fluorophenyl)furan-2-carboxamide (PubChem CID 7279741) has the molecular formula C20H17FN2O4 and a molecular weight of 368.36 g/mol. Its IUPAC name is N-[[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]methyl]-N-(4-fluorophenyl)furan-2-carboxamide.
| Compound Name | N-[[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]methyl]-N-(4-fluorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 7279741 |
| Molecular Formula | C20H17FN2O4 |
| Molecular Weight | 368.36 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | N-[[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]methyl]-N-(4-fluorophenyl)furan-2-carboxamide |
| SMILES | O=C1[C@@H]2CC=CC[C@H]2C(=O)N1CN(C(=O)c1ccco1)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H17FN2O4/c21-13-7-9-14(10-8-13)22(20(26)17-6-3-11-27-17)12-23-18(24)15-4-1-2-5-16(15)19(23)25/h1-3,6-11,15-16H,4-5,12H2/t15-,16-/m1/s1 |
| InChIKey | ZOYHOQCQPIDLCF-HZPDHXFCSA-N |
| XLogP | 2.97 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.36 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|