C16H11NO7 — CID 691329
[2-[(1,3-dioxoisoindol-2-yl)methoxy]-2-oxoethyl] furan-2-carboxylate (PubChem CID 691329) has the molecular formula C16H11NO7 and a molecular weight of 329.26 g/mol. Its IUPAC name is [2-[(1,3-dioxoisoindol-2-yl)methoxy]-2-oxoethyl] furan-2-carboxylate.
| Compound Name | [2-[(1,3-dioxoisoindol-2-yl)methoxy]-2-oxoethyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 691329 |
| Molecular Formula | C16H11NO7 |
| Molecular Weight | 329.26 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | [2-[(1,3-dioxoisoindol-2-yl)methoxy]-2-oxoethyl] furan-2-carboxylate |
| SMILES | O=C(COC(=O)c1ccco1)OCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C16H11NO7/c18-13(8-23-16(21)12-6-3-7-22-12)24-9-17-14(19)10-4-1-2-5-11(10)15(17)20/h1-7H,8-9H2 |
| InChIKey | KNLYQVKQNGMFKP-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 103.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.26 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|