C19H17NO5 — CID 3502927
(1,3-dioxoisoindol-2-yl)methyl 2-(3,4-dimethylphenoxy)acetate (PubChem CID 3502927) has the molecular formula C19H17NO5 and a molecular weight of 339.35 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl)methyl 2-(3,4-dimethylphenoxy)acetate.
| Compound Name | (1,3-dioxoisoindol-2-yl)methyl 2-(3,4-dimethylphenoxy)acetate |
|---|---|
| PubChem CID | 3502927 |
| Molecular Formula | C19H17NO5 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl)methyl 2-(3,4-dimethylphenoxy)acetate |
| SMILES | Cc1ccc(OCC(=O)OCN2C(=O)c3ccccc3C2=O)cc1C |
| InChI | InChI=1S/C19H17NO5/c1-12-7-8-14(9-13(12)2)24-10-17(21)25-11-20-18(22)15-5-3-4-6-16(15)19(20)23/h3-9H,10-11H2,1-2H3 |
| InChIKey | XVMPSBPDJOXVDM-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|