(2-oxo-2-pyrrolidin-1-ylethyl) 2-(3,4-dimethylphenoxy)acetate

C16H21NO4 — CID 23905536

IUPAC(2-oxo-2-pyrrolidin-1-ylethyl) 2-(3,4-dimethylphenoxy)acetate
SMILESCc1ccc(OCC(=O)OCC(=O)N2CCCC2)cc1C
InChIInChI=1S/C16H21NO4/c1-12-5-6-14(9-13(12)2)20-11-16(19)21-10-15(18)17-7-3-4-8-17/h5-6,9H,3-4,7-8,10-11H2,1-2H3
InChIKeyXCPHOOYZICQRGQ-UHFFFAOYSA-N
MW291.35 g/mol
LogP1.85
Rot. Bonds5

About (2-oxo-2-pyrrolidin-1-ylethyl) 2-(3,4-dimethylphenoxy)acetate

(2-oxo-2-pyrrolidin-1-ylethyl) 2-(3,4-dimethylphenoxy)acetate (PubChem CID 23905536) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is (2-oxo-2-pyrrolidin-1-ylethyl) 2-(3,4-dimethylphenoxy)acetate.

Molecular Properties

Compound Name(2-oxo-2-pyrrolidin-1-ylethyl) 2-(3,4-dimethylphenoxy)acetate
PubChem CID23905536
Molecular FormulaC16H21NO4
Molecular Weight291.35 g/mol
Exact Mass291.15
IUPAC Name(2-oxo-2-pyrrolidin-1-ylethyl) 2-(3,4-dimethylphenoxy)acetate
SMILESCc1ccc(OCC(=O)OCC(=O)N2CCCC2)cc1C
InChIInChI=1S/C16H21NO4/c1-12-5-6-14(9-13(12)2)20-11-16(19)21-10-15(18)17-7-3-4-8-17/h5-6,9H,3-4,7-8,10-11H2,1-2H3
InChIKeyXCPHOOYZICQRGQ-UHFFFAOYSA-N
XLogP1.85
TPSA55.84 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500291.35
LogP ≤ 51.85
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze (2-oxo-2-pyrrolidin-1-ylethyl) 2-(3,4-dimethylphenoxy)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2-oxo-2-pyrrolidin-1-ylethyl) 2-(3,4-dimethylphenoxy)acetate?
The IUPAC name of (2-oxo-2-pyrrolidin-1-ylethyl) 2-(3,4-dimethylphenoxy)acetate (CID 23905536) is (2-oxo-2-pyrrolidin-1-ylethyl) 2-(3,4-dimethylphenoxy)acetate.
What is the SMILES notation for (2-oxo-2-pyrrolidin-1-ylethyl) 2-(3,4-dimethylphenoxy)acetate?
The canonical SMILES for (2-oxo-2-pyrrolidin-1-ylethyl) 2-(3,4-dimethylphenoxy)acetate is Cc1ccc(OCC(=O)OCC(=O)N2CCCC2)cc1C.
What is the InChIKey of (2-oxo-2-pyrrolidin-1-ylethyl) 2-(3,4-dimethylphenoxy)acetate?
The InChIKey is XCPHOOYZICQRGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21NO4/c1-12-5-6-14(9-13(12)2)20-11-16(19)21-10-15(18)17-7-3-4-8-17/h5-6,9H,3-4,7-8,10-11H2,1-2H3.
What are the key properties of (2-oxo-2-pyrrolidin-1-ylethyl) 2-(3,4-dimethylphenoxy)acetate?
(2-oxo-2-pyrrolidin-1-ylethyl) 2-(3,4-dimethylphenoxy)acetate has a molecular weight of 291.35 g/mol, XLogP of 1.85, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxo-2-pyrrolidin-1-ylethyl) 2-(3,4-dimethylphenoxy)acetate is sourced from PubChem (CID 23905536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).