C16H21NO4 — CID 23905536
(2-oxo-2-pyrrolidin-1-ylethyl) 2-(3,4-dimethylphenoxy)acetate (PubChem CID 23905536) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is (2-oxo-2-pyrrolidin-1-ylethyl) 2-(3,4-dimethylphenoxy)acetate.
| Compound Name | (2-oxo-2-pyrrolidin-1-ylethyl) 2-(3,4-dimethylphenoxy)acetate |
|---|---|
| PubChem CID | 23905536 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | (2-oxo-2-pyrrolidin-1-ylethyl) 2-(3,4-dimethylphenoxy)acetate |
| SMILES | Cc1ccc(OCC(=O)OCC(=O)N2CCCC2)cc1C |
| InChI | InChI=1S/C16H21NO4/c1-12-5-6-14(9-13(12)2)20-11-16(19)21-10-15(18)17-7-3-4-8-17/h5-6,9H,3-4,7-8,10-11H2,1-2H3 |
| InChIKey | XCPHOOYZICQRGQ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |