C33H22N4O8 — CID 5126405
N-[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl]-3,5-dinitro-N-(4-phenoxyphenyl)benzamide (PubChem CID 5126405) has the molecular formula C33H22N4O8 and a molecular weight of 602.56 g/mol. Its IUPAC name is N-[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl]-3,5-dinitro-N-(4-phenoxyphenyl)benzamide.
| Compound Name | N-[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl]-3,5-dinitro-N-(4-phenoxyphenyl)benzamide |
|---|---|
| PubChem CID | 5126405 |
| Molecular Formula | C33H22N4O8 |
| Molecular Weight | 602.56 g/mol |
| Exact Mass | 602.14 |
| IUPAC Name | N-[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl]-3,5-dinitro-N-(4-phenoxyphenyl)benzamide |
| SMILES | O=C1c2cccc3cccc(c23)C(=O)N1CCN(C(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C33H22N4O8/c38-31(22-18-24(36(41)42)20-25(19-22)37(43)44)34(23-12-14-27(15-13-23)45-26-8-2-1-3-9-26)16-17-35-32(39)28-10-4-6-21-7-5-11-29(30(21)28)33(35)40/h1-15,18-20H,16-17H2 |
| InChIKey | YFBPONGGXABHDP-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 153.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.56 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|