C30H26N2O3 — CID 4036484
N-[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl]-3,5-dimethyl-N-(2-methylphenyl)benzamide (PubChem CID 4036484) has the molecular formula C30H26N2O3 and a molecular weight of 462.55 g/mol. Its IUPAC name is N-[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl]-3,5-dimethyl-N-(2-methylphenyl)benzamide.
| Compound Name | N-[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl]-3,5-dimethyl-N-(2-methylphenyl)benzamide |
|---|---|
| PubChem CID | 4036484 |
| Molecular Formula | C30H26N2O3 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | N-[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl]-3,5-dimethyl-N-(2-methylphenyl)benzamide |
| SMILES | Cc1cc(C)cc(C(=O)N(CCN2C(=O)c3cccc4cccc(c34)C2=O)c2ccccc2C)c1 |
| InChI | InChI=1S/C30H26N2O3/c1-19-16-20(2)18-23(17-19)28(33)31(26-13-5-4-8-21(26)3)14-15-32-29(34)24-11-6-9-22-10-7-12-25(27(22)24)30(32)35/h4-13,16-18H,14-15H2,1-3H3 |
| InChIKey | MRUNOBGJXPCEHQ-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|