C31H28N2O4 — CID 5114854
N-(2,4-dimethylphenyl)-N-[3-(1,3-dioxobenzo[de]isoquinolin-2-yl)propyl]-3-methoxybenzamide (PubChem CID 5114854) has the molecular formula C31H28N2O4 and a molecular weight of 492.58 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-N-[3-(1,3-dioxobenzo[de]isoquinolin-2-yl)propyl]-3-methoxybenzamide.
| Compound Name | N-(2,4-dimethylphenyl)-N-[3-(1,3-dioxobenzo[de]isoquinolin-2-yl)propyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 5114854 |
| Molecular Formula | C31H28N2O4 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | N-(2,4-dimethylphenyl)-N-[3-(1,3-dioxobenzo[de]isoquinolin-2-yl)propyl]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)N(CCCN2C(=O)c3cccc4cccc(c34)C2=O)c2ccc(C)cc2C)c1 |
| InChI | InChI=1S/C31H28N2O4/c1-20-14-15-27(21(2)18-20)32(29(34)23-10-4-11-24(19-23)37-3)16-7-17-33-30(35)25-12-5-8-22-9-6-13-26(28(22)25)31(33)36/h4-6,8-15,18-19H,7,16-17H2,1-3H3 |
| InChIKey | PPRQPFZFJUXBPT-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|