C32H32N2O4 — CID 3617336
N-[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl]-N-(3-methoxyphenyl)adamantane-1-carboxamide (PubChem CID 3617336) has the molecular formula C32H32N2O4 and a molecular weight of 508.62 g/mol. Its IUPAC name is N-[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl]-N-(3-methoxyphenyl)adamantane-1-carboxamide.
| Compound Name | N-[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl]-N-(3-methoxyphenyl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 3617336 |
| Molecular Formula | C32H32N2O4 |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.24 |
| IUPAC Name | N-[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl]-N-(3-methoxyphenyl)adamantane-1-carboxamide |
| SMILES | COc1cccc(N(CCN2C(=O)c3cccc4cccc(c34)C2=O)C(=O)C23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C32H32N2O4/c1-38-25-8-4-7-24(16-25)33(31(37)32-17-20-13-21(18-32)15-22(14-20)19-32)11-12-34-29(35)26-9-2-5-23-6-3-10-27(28(23)26)30(34)36/h2-10,16,20-22H,11-15,17-19H2,1H3 |
| InChIKey | XCHVHXXNKJEUCO-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|