C27H28N2O3 — CID 5234030
N-(2,4-dimethylphenyl)-N-[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl]pentanamide (PubChem CID 5234030) has the molecular formula C27H28N2O3 and a molecular weight of 428.53 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-N-[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl]pentanamide.
| Compound Name | N-(2,4-dimethylphenyl)-N-[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl]pentanamide |
|---|---|
| PubChem CID | 5234030 |
| Molecular Formula | C27H28N2O3 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | N-(2,4-dimethylphenyl)-N-[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl]pentanamide |
| SMILES | CCCCC(=O)N(CCN1C(=O)c2cccc3cccc(c23)C1=O)c1ccc(C)cc1C |
| InChI | InChI=1S/C27H28N2O3/c1-4-5-12-24(30)28(23-14-13-18(2)17-19(23)3)15-16-29-26(31)21-10-6-8-20-9-7-11-22(25(20)21)27(29)32/h6-11,13-14,17H,4-5,12,15-16H2,1-3H3 |
| InChIKey | CYDPUELIXKRVJU-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|