C29H24N2O3 — CID 4036482
N-[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl]-4-methyl-N-(2-methylphenyl)benzamide (PubChem CID 4036482) has the molecular formula C29H24N2O3 and a molecular weight of 448.52 g/mol. Its IUPAC name is N-[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl]-4-methyl-N-(2-methylphenyl)benzamide.
| Compound Name | N-[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl]-4-methyl-N-(2-methylphenyl)benzamide |
|---|---|
| PubChem CID | 4036482 |
| Molecular Formula | C29H24N2O3 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | N-[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl]-4-methyl-N-(2-methylphenyl)benzamide |
| SMILES | Cc1ccc(C(=O)N(CCN2C(=O)c3cccc4cccc(c34)C2=O)c2ccccc2C)cc1 |
| InChI | InChI=1S/C29H24N2O3/c1-19-13-15-22(16-14-19)27(32)30(25-12-4-3-7-20(25)2)17-18-31-28(33)23-10-5-8-21-9-6-11-24(26(21)23)29(31)34/h3-16H,17-18H2,1-2H3 |
| InChIKey | UZGYBUJQOHFBNR-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|