C24H19FN2O4 — CID 4682355
N-[2-(1,3-dioxoisoindol-2-yl)ethyl]-4-fluoro-N-(2-methoxyphenyl)benzamide (PubChem CID 4682355) has the molecular formula C24H19FN2O4 and a molecular weight of 418.42 g/mol. Its IUPAC name is N-[2-(1,3-dioxoisoindol-2-yl)ethyl]-4-fluoro-N-(2-methoxyphenyl)benzamide.
| Compound Name | N-[2-(1,3-dioxoisoindol-2-yl)ethyl]-4-fluoro-N-(2-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 4682355 |
| Molecular Formula | C24H19FN2O4 |
| Molecular Weight | 418.42 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | N-[2-(1,3-dioxoisoindol-2-yl)ethyl]-4-fluoro-N-(2-methoxyphenyl)benzamide |
| SMILES | COc1ccccc1N(CCN1C(=O)c2ccccc2C1=O)C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H19FN2O4/c1-31-21-9-5-4-8-20(21)26(22(28)16-10-12-17(25)13-11-16)14-15-27-23(29)18-6-2-3-7-19(18)24(27)30/h2-13H,14-15H2,1H3 |
| InChIKey | TZZDKYLITZIARA-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.42 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|