C32H30N2O4 — CID 3918544
N-(4-tert-butylphenyl)-N-[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl]-2-methoxybenzamide (PubChem CID 3918544) has the molecular formula C32H30N2O4 and a molecular weight of 506.60 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-N-[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl]-2-methoxybenzamide.
| Compound Name | N-(4-tert-butylphenyl)-N-[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 3918544 |
| Molecular Formula | C32H30N2O4 |
| Molecular Weight | 506.60 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | N-(4-tert-butylphenyl)-N-[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)N(CCN1C(=O)c2cccc3cccc(c23)C1=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C32H30N2O4/c1-32(2,3)22-15-17-23(18-16-22)33(29(35)24-11-5-6-14-27(24)38-4)19-20-34-30(36)25-12-7-9-21-10-8-13-26(28(21)25)31(34)37/h5-18H,19-20H2,1-4H3 |
| InChIKey | VGLRKYYZRRVRKI-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.60 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|