C36H39N3O5S — CID 3938824
N-(4-tert-butylphenyl)-4-(diethylsulfamoyl)-N-[3-(1,3-dioxobenzo[de]isoquinolin-2-yl)propyl]benzamide (PubChem CID 3938824) has the molecular formula C36H39N3O5S and a molecular weight of 625.79 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-4-(diethylsulfamoyl)-N-[3-(1,3-dioxobenzo[de]isoquinolin-2-yl)propyl]benzamide.
| Compound Name | N-(4-tert-butylphenyl)-4-(diethylsulfamoyl)-N-[3-(1,3-dioxobenzo[de]isoquinolin-2-yl)propyl]benzamide |
|---|---|
| PubChem CID | 3938824 |
| Molecular Formula | C36H39N3O5S |
| Molecular Weight | 625.79 g/mol |
| Exact Mass | 625.26 |
| IUPAC Name | N-(4-tert-butylphenyl)-4-(diethylsulfamoyl)-N-[3-(1,3-dioxobenzo[de]isoquinolin-2-yl)propyl]benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(=O)N(CCCN2C(=O)c3cccc4cccc(c34)C2=O)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C36H39N3O5S/c1-6-37(7-2)45(43,44)29-21-15-26(16-22-29)33(40)38(28-19-17-27(18-20-28)36(3,4)5)23-10-24-39-34(41)30-13-8-11-25-12-9-14-31(32(25)30)35(39)42/h8-9,11-22H,6-7,10,23-24H2,1-5H3 |
| InChIKey | ZRRLMHZNGRDMNP-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 95.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.79 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|