C28H33NO3S — CID 19211041
4-tert-butyl-N-(4-butylphenyl)-N-(4-methylphenyl)sulfonylbenzamide (PubChem CID 19211041) has the molecular formula C28H33NO3S and a molecular weight of 463.64 g/mol. Its IUPAC name is 4-tert-butyl-N-(4-butylphenyl)-N-(4-methylphenyl)sulfonylbenzamide.
| Compound Name | 4-tert-butyl-N-(4-butylphenyl)-N-(4-methylphenyl)sulfonylbenzamide |
|---|---|
| PubChem CID | 19211041 |
| Molecular Formula | C28H33NO3S |
| Molecular Weight | 463.64 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | 4-tert-butyl-N-(4-butylphenyl)-N-(4-methylphenyl)sulfonylbenzamide |
| SMILES | CCCCc1ccc(N(C(=O)c2ccc(C(C)(C)C)cc2)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C28H33NO3S/c1-6-7-8-22-11-17-25(18-12-22)29(33(31,32)26-19-9-21(2)10-20-26)27(30)23-13-15-24(16-14-23)28(3,4)5/h9-20H,6-8H2,1-5H3 |
| InChIKey | LIRNBTRDRVMVTQ-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.64 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |