C15H15NO5 — CID 788372
5,5-dimethyl-2-(4-nitrobenzoyl)cyclohexane-1,3-dione (PubChem CID 788372) has the molecular formula C15H15NO5 and a molecular weight of 289.29 g/mol. Its IUPAC name is 5,5-dimethyl-2-(4-nitrobenzoyl)cyclohexane-1,3-dione.
| Compound Name | 5,5-dimethyl-2-(4-nitrobenzoyl)cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 788372 |
| Molecular Formula | C15H15NO5 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 5,5-dimethyl-2-(4-nitrobenzoyl)cyclohexane-1,3-dione |
| SMILES | CC1(C)CC(=O)C(C(=O)c2ccc([N+](=O)[O-])cc2)C(=O)C1 |
| InChI | InChI=1S/C15H15NO5/c1-15(2)7-11(17)13(12(18)8-15)14(19)9-3-5-10(6-4-9)16(20)21/h3-6,13H,7-8H2,1-2H3 |
| InChIKey | KESBOEBJMZKRMH-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 94.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|