C16H21NO4 — CID 90800279
(4-nitrophenyl)-(3,3,6,6-tetramethyloxan-2-yl)methanone (PubChem CID 90800279) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is (4-nitrophenyl)-(3,3,6,6-tetramethyloxan-2-yl)methanone.
| Compound Name | (4-nitrophenyl)-(3,3,6,6-tetramethyloxan-2-yl)methanone |
|---|---|
| PubChem CID | 90800279 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | (4-nitrophenyl)-(3,3,6,6-tetramethyloxan-2-yl)methanone |
| SMILES | CC1(C)CCC(C)(C)C(C(=O)c2ccc([N+](=O)[O-])cc2)O1 |
| InChI | InChI=1S/C16H21NO4/c1-15(2)9-10-16(3,4)21-14(15)13(18)11-5-7-12(8-6-11)17(19)20/h5-8,14H,9-10H2,1-4H3 |
| InChIKey | JTVJMVPESXRZHT-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|