C13H9NO3 — CID 15555294
(4-nitrophenyl)-(2,3,4,5,6-pentadeuteriophenyl)methanone (PubChem CID 15555294) has the molecular formula C13H9NO3 and a molecular weight of 232.25 g/mol. Its IUPAC name is (4-nitrophenyl)-(2,3,4,5,6-pentadeuteriophenyl)methanone.
| Compound Name | (4-nitrophenyl)-(2,3,4,5,6-pentadeuteriophenyl)methanone |
|---|---|
| PubChem CID | 15555294 |
| Molecular Formula | C13H9NO3 |
| Molecular Weight | 232.25 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | (4-nitrophenyl)-(2,3,4,5,6-pentadeuteriophenyl)methanone |
| SMILES | [2H]c1c([2H])c([2H])c(C(=O)c2ccc([N+](=O)[O-])cc2)c([2H])c1[2H] |
| InChI | InChI=1S/C13H9NO3/c15-13(10-4-2-1-3-5-10)11-6-8-12(9-7-11)14(16)17/h1-9H/i1D,2D,3D,4D,5D |
| InChIKey | ZYMCBJWUWHHVRX-RALIUCGRSA-N |
| XLogP | 2.83 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.25 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|