C28H31N5O5S2 — CID 23966683
4-(4-nitrobenzoyl)-2-(piperazine-1-carbonyl)-N-propan-2-yl-3,5-dithiophen-2-ylpyrrolidine-1-carboxamide (PubChem CID 23966683) has the molecular formula C28H31N5O5S2 and a molecular weight of 581.72 g/mol. Its IUPAC name is 4-(4-nitrobenzoyl)-2-(piperazine-1-carbonyl)-N-propan-2-yl-3,5-dithiophen-2-ylpyrrolidine-1-carboxamide.
| Compound Name | 4-(4-nitrobenzoyl)-2-(piperazine-1-carbonyl)-N-propan-2-yl-3,5-dithiophen-2-ylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 23966683 |
| Molecular Formula | C28H31N5O5S2 |
| Molecular Weight | 581.72 g/mol |
| Exact Mass | 581.18 |
| IUPAC Name | 4-(4-nitrobenzoyl)-2-(piperazine-1-carbonyl)-N-propan-2-yl-3,5-dithiophen-2-ylpyrrolidine-1-carboxamide |
| SMILES | CC(C)NC(=O)N1C(C(=O)N2CCNCC2)C(c2cccs2)C(C(=O)c2ccc([N+](=O)[O-])cc2)C1c1cccs1 |
| InChI | InChI=1S/C28H31N5O5S2/c1-17(2)30-28(36)32-24(21-6-4-16-40-21)23(26(34)18-7-9-19(10-8-18)33(37)38)22(20-5-3-15-39-20)25(32)27(35)31-13-11-29-12-14-31/h3-10,15-17,22-25,29H,11-14H2,1-2H3,(H,30,36) |
| InChIKey | NNHACTCNXOSLNS-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 124.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.72 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|