C34H38N4O5 — CID 23848217
1-[3-benzoyl-2-(4-methylphenyl)-4-(4-nitrophenyl)-5-(piperazine-1-carbonyl)pyrrolidin-1-yl]-3-methylbutan-1-one (PubChem CID 23848217) has the molecular formula C34H38N4O5 and a molecular weight of 582.70 g/mol. Its IUPAC name is 1-[3-benzoyl-2-(4-methylphenyl)-4-(4-nitrophenyl)-5-(piperazine-1-carbonyl)pyrrolidin-1-yl]-3-methylbutan-1-one.
| Compound Name | 1-[3-benzoyl-2-(4-methylphenyl)-4-(4-nitrophenyl)-5-(piperazine-1-carbonyl)pyrrolidin-1-yl]-3-methylbutan-1-one |
|---|---|
| PubChem CID | 23848217 |
| Molecular Formula | C34H38N4O5 |
| Molecular Weight | 582.70 g/mol |
| Exact Mass | 582.28 |
| IUPAC Name | 1-[3-benzoyl-2-(4-methylphenyl)-4-(4-nitrophenyl)-5-(piperazine-1-carbonyl)pyrrolidin-1-yl]-3-methylbutan-1-one |
| SMILES | Cc1ccc(C2C(C(=O)c3ccccc3)C(c3ccc([N+](=O)[O-])cc3)C(C(=O)N3CCNCC3)N2C(=O)CC(C)C)cc1 |
| InChI | InChI=1S/C34H38N4O5/c1-22(2)21-28(39)37-31(25-11-9-23(3)10-12-25)30(33(40)26-7-5-4-6-8-26)29(24-13-15-27(16-14-24)38(42)43)32(37)34(41)36-19-17-35-18-20-36/h4-16,22,29-32,35H,17-21H2,1-3H3 |
| InChIKey | JDFOFZUATZDWOB-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 112.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.70 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|