C26H22ClN3O5S — CID 23740266
4-(3-chlorobenzoyl)-1-(cyclopropanecarbonyl)-5-(3-nitrophenyl)-3-thiophen-2-ylpyrrolidine-2-carboxamide (PubChem CID 23740266) has the molecular formula C26H22ClN3O5S and a molecular weight of 524.00 g/mol. Its IUPAC name is 4-(3-chlorobenzoyl)-1-(cyclopropanecarbonyl)-5-(3-nitrophenyl)-3-thiophen-2-ylpyrrolidine-2-carboxamide.
| Compound Name | 4-(3-chlorobenzoyl)-1-(cyclopropanecarbonyl)-5-(3-nitrophenyl)-3-thiophen-2-ylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 23740266 |
| Molecular Formula | C26H22ClN3O5S |
| Molecular Weight | 524.00 g/mol |
| Exact Mass | 523.10 |
| IUPAC Name | 4-(3-chlorobenzoyl)-1-(cyclopropanecarbonyl)-5-(3-nitrophenyl)-3-thiophen-2-ylpyrrolidine-2-carboxamide |
| SMILES | NC(=O)C1C(c2cccs2)C(C(=O)c2cccc(Cl)c2)C(c2cccc([N+](=O)[O-])c2)N1C(=O)C1CC1 |
| InChI | InChI=1S/C26H22ClN3O5S/c27-17-6-1-5-16(12-17)24(31)21-20(19-8-3-11-36-19)23(25(28)32)29(26(33)14-9-10-14)22(21)15-4-2-7-18(13-15)30(34)35/h1-8,11-14,20-23H,9-10H2,(H2,28,32) |
| InChIKey | QFBAAYWEGUCDIZ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 123.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.00 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|