C30H24ClN3O6S — CID 23789726
3-(4-chlorophenyl)-2-methyl-5-(3-nitrophenyl)-1-(phenylcarbamoyl)-4-(thiophene-2-carbonyl)pyrrolidine-2-carboxylic acid (PubChem CID 23789726) has the molecular formula C30H24ClN3O6S and a molecular weight of 590.06 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-2-methyl-5-(3-nitrophenyl)-1-(phenylcarbamoyl)-4-(thiophene-2-carbonyl)pyrrolidine-2-carboxylic acid.
| Compound Name | 3-(4-chlorophenyl)-2-methyl-5-(3-nitrophenyl)-1-(phenylcarbamoyl)-4-(thiophene-2-carbonyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 23789726 |
| Molecular Formula | C30H24ClN3O6S |
| Molecular Weight | 590.06 g/mol |
| Exact Mass | 589.11 |
| IUPAC Name | 3-(4-chlorophenyl)-2-methyl-5-(3-nitrophenyl)-1-(phenylcarbamoyl)-4-(thiophene-2-carbonyl)pyrrolidine-2-carboxylic acid |
| SMILES | CC1(C(=O)O)C(c2ccc(Cl)cc2)C(C(=O)c2cccs2)C(c2cccc([N+](=O)[O-])c2)N1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C30H24ClN3O6S/c1-30(28(36)37)25(18-12-14-20(31)15-13-18)24(27(35)23-11-6-16-41-23)26(19-7-5-10-22(17-19)34(39)40)33(30)29(38)32-21-8-3-2-4-9-21/h2-17,24-26H,1H3,(H,32,38)(H,36,37) |
| InChIKey | WUWIRVQAXCOSPM-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 129.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.06 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|