C29H27ClN2O7S — CID 23790096
4-(5-chlorothiophene-2-carbonyl)-1-(cyclobutanecarbonyl)-3-(3-methoxyphenyl)-2-methyl-5-(3-nitrophenyl)pyrrolidine-2-carboxylic acid (PubChem CID 23790096) has the molecular formula C29H27ClN2O7S and a molecular weight of 583.06 g/mol. Its IUPAC name is 4-(5-chlorothiophene-2-carbonyl)-1-(cyclobutanecarbonyl)-3-(3-methoxyphenyl)-2-methyl-5-(3-nitrophenyl)pyrrolidine-2-carboxylic acid.
| Compound Name | 4-(5-chlorothiophene-2-carbonyl)-1-(cyclobutanecarbonyl)-3-(3-methoxyphenyl)-2-methyl-5-(3-nitrophenyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 23790096 |
| Molecular Formula | C29H27ClN2O7S |
| Molecular Weight | 583.06 g/mol |
| Exact Mass | 582.12 |
| IUPAC Name | 4-(5-chlorothiophene-2-carbonyl)-1-(cyclobutanecarbonyl)-3-(3-methoxyphenyl)-2-methyl-5-(3-nitrophenyl)pyrrolidine-2-carboxylic acid |
| SMILES | COc1cccc(C2C(C(=O)c3ccc(Cl)s3)C(c3cccc([N+](=O)[O-])c3)N(C(=O)C3CCC3)C2(C)C(=O)O)c1 |
| InChI | InChI=1S/C29H27ClN2O7S/c1-29(28(35)36)24(17-8-5-11-20(15-17)39-2)23(26(33)21-12-13-22(30)40-21)25(31(29)27(34)16-6-3-7-16)18-9-4-10-19(14-18)32(37)38/h4-5,8-16,23-25H,3,6-7H2,1-2H3,(H,35,36) |
| InChIKey | SEIRCBVRSWXKEQ-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 127.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.06 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|