C15H14N4O7 — CID 70092829
5-methyl-7-(3-nitrophenyl)-2-oxo-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-1,6-dicarboxylic acid (PubChem CID 70092829) has the molecular formula C15H14N4O7 and a molecular weight of 362.30 g/mol. Its IUPAC name is 5-methyl-7-(3-nitrophenyl)-2-oxo-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-1,6-dicarboxylic acid.
| Compound Name | 5-methyl-7-(3-nitrophenyl)-2-oxo-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-1,6-dicarboxylic acid |
|---|---|
| PubChem CID | 70092829 |
| Molecular Formula | C15H14N4O7 |
| Molecular Weight | 362.30 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | 5-methyl-7-(3-nitrophenyl)-2-oxo-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-1,6-dicarboxylic acid |
| SMILES | CC1Nc2cc(=O)n(C(=O)O)n2C(c2cccc([N+](=O)[O-])c2)C1C(=O)O |
| InChI | InChI=1S/C15H14N4O7/c1-7-12(14(21)22)13(8-3-2-4-9(5-8)19(25)26)17-10(16-7)6-11(20)18(17)15(23)24/h2-7,12-13,16H,1H3,(H,21,22)(H,23,24) |
| InChIKey | SOKTXKOQWTYFGX-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 156.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.30 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|