C31H32N4O6S — CID 23770101
3-(4-acetamidophenyl)-1-(cyclobutanecarbonyl)-4-(2,5-dimethylthiophene-3-carbonyl)-5-(3-nitrophenyl)pyrrolidine-2-carboxamide (PubChem CID 23770101) has the molecular formula C31H32N4O6S and a molecular weight of 588.69 g/mol. Its IUPAC name is 3-(4-acetamidophenyl)-1-(cyclobutanecarbonyl)-4-(2,5-dimethylthiophene-3-carbonyl)-5-(3-nitrophenyl)pyrrolidine-2-carboxamide.
| Compound Name | 3-(4-acetamidophenyl)-1-(cyclobutanecarbonyl)-4-(2,5-dimethylthiophene-3-carbonyl)-5-(3-nitrophenyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 23770101 |
| Molecular Formula | C31H32N4O6S |
| Molecular Weight | 588.69 g/mol |
| Exact Mass | 588.20 |
| IUPAC Name | 3-(4-acetamidophenyl)-1-(cyclobutanecarbonyl)-4-(2,5-dimethylthiophene-3-carbonyl)-5-(3-nitrophenyl)pyrrolidine-2-carboxamide |
| SMILES | CC(=O)Nc1ccc(C2C(C(=O)c3cc(C)sc3C)C(c3cccc([N+](=O)[O-])c3)N(C(=O)C3CCC3)C2C(N)=O)cc1 |
| InChI | InChI=1S/C31H32N4O6S/c1-16-14-24(17(2)42-16)29(37)26-25(19-10-12-22(13-11-19)33-18(3)36)28(30(32)38)34(31(39)20-6-4-7-20)27(26)21-8-5-9-23(15-21)35(40)41/h5,8-15,20,25-28H,4,6-7H2,1-3H3,(H2,32,38)(H,33,36) |
| InChIKey | CKQKPBVZKBXFQL-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 152.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.69 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|