C28H30N4O4S — CID 92686577
(3S,4R)-2-(2-methylpropyl)-4-[4-(4-nitrophenyl)piperazine-1-carbonyl]-3-thiophen-2-yl-3,4-dihydroisoquinolin-1-one (PubChem CID 92686577) has the molecular formula C28H30N4O4S and a molecular weight of 518.64 g/mol. Its IUPAC name is (3S,4R)-2-(2-methylpropyl)-4-[4-(4-nitrophenyl)piperazine-1-carbonyl]-3-thiophen-2-yl-3,4-dihydroisoquinolin-1-one.
| Compound Name | (3S,4R)-2-(2-methylpropyl)-4-[4-(4-nitrophenyl)piperazine-1-carbonyl]-3-thiophen-2-yl-3,4-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 92686577 |
| Molecular Formula | C28H30N4O4S |
| Molecular Weight | 518.64 g/mol |
| Exact Mass | 518.20 |
| IUPAC Name | (3S,4R)-2-(2-methylpropyl)-4-[4-(4-nitrophenyl)piperazine-1-carbonyl]-3-thiophen-2-yl-3,4-dihydroisoquinolin-1-one |
| SMILES | CC(C)CN1C(=O)c2ccccc2[C@@H](C(=O)N2CCN(c3ccc([N+](=O)[O-])cc3)CC2)[C@H]1c1cccs1 |
| InChI | InChI=1S/C28H30N4O4S/c1-19(2)18-31-26(24-8-5-17-37-24)25(22-6-3-4-7-23(22)27(31)33)28(34)30-15-13-29(14-16-30)20-9-11-21(12-10-20)32(35)36/h3-12,17,19,25-26H,13-16,18H2,1-2H3/t25-,26-/m1/s1 |
| InChIKey | SSKMUBASSIEJMA-CLJLJLNGSA-N |
| XLogP | 4.94 |
| TPSA | 87.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.64 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|