C20H21NO4 — CID 56649669
(Z)-3-(3,5-dimethoxyphenyl)-3-(3-ethoxy-4-methoxyphenyl)prop-2-enenitrile (PubChem CID 56649669) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is (Z)-3-(3,5-dimethoxyphenyl)-3-(3-ethoxy-4-methoxyphenyl)prop-2-enenitrile.
| Compound Name | (Z)-3-(3,5-dimethoxyphenyl)-3-(3-ethoxy-4-methoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 56649669 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | (Z)-3-(3,5-dimethoxyphenyl)-3-(3-ethoxy-4-methoxyphenyl)prop-2-enenitrile |
| SMILES | CCOc1cc(/C(=C/C#N)c2cc(OC)cc(OC)c2)ccc1OC |
| InChI | InChI=1S/C20H21NO4/c1-5-25-20-12-14(6-7-19(20)24-4)18(8-9-21)15-10-16(22-2)13-17(11-15)23-3/h6-8,10-13H,5H2,1-4H3/b18-8- |
| InChIKey | UZJJLBYHSDGPBB-LSCVHKIXSA-N |
| XLogP | 4.07 |
| TPSA | 60.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|