C20H20O4 — CID 58607138
1-[1-(3,4-dimethoxyphenyl)but-1-en-3-ynyl]-3,5-dimethoxybenzene (PubChem CID 58607138) has the molecular formula C20H20O4 and a molecular weight of 324.38 g/mol. Its IUPAC name is 1-[1-(3,4-dimethoxyphenyl)but-1-en-3-ynyl]-3,5-dimethoxybenzene.
| Compound Name | 1-[1-(3,4-dimethoxyphenyl)but-1-en-3-ynyl]-3,5-dimethoxybenzene |
|---|---|
| PubChem CID | 58607138 |
| Molecular Formula | C20H20O4 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 1-[1-(3,4-dimethoxyphenyl)but-1-en-3-ynyl]-3,5-dimethoxybenzene |
| SMILES | C#CC=C(c1cc(OC)cc(OC)c1)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C20H20O4/c1-6-7-18(14-8-9-19(23-4)20(12-14)24-5)15-10-16(21-2)13-17(11-15)22-3/h1,7-13H,2-5H3 |
| InChIKey | DZQNMUJLJIRTDO-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|