C17H19NO4S — CID 10314774
N-(3,5-dimethoxyphenyl)-3,4-dimethoxybenzenecarbothioamide (PubChem CID 10314774) has the molecular formula C17H19NO4S and a molecular weight of 333.41 g/mol. Its IUPAC name is N-(3,5-dimethoxyphenyl)-3,4-dimethoxybenzenecarbothioamide.
| Compound Name | N-(3,5-dimethoxyphenyl)-3,4-dimethoxybenzenecarbothioamide |
|---|---|
| PubChem CID | 10314774 |
| Molecular Formula | C17H19NO4S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | N-(3,5-dimethoxyphenyl)-3,4-dimethoxybenzenecarbothioamide |
| SMILES | COc1cc(NC(=S)c2ccc(OC)c(OC)c2)cc(OC)c1 |
| InChI | InChI=1S/C17H19NO4S/c1-19-13-8-12(9-14(10-13)20-2)18-17(23)11-5-6-15(21-3)16(7-11)22-4/h5-10H,1-4H3,(H,18,23) |
| InChIKey | HJVCGJNTGNTMAC-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|