C21H22N4O6 — CID 53118349
1-(3,5-dimethoxyphenyl)-3-[4-(3,4-dimethoxyphenyl)-3-oxopyrazin-2-yl]urea (PubChem CID 53118349) has the molecular formula C21H22N4O6 and a molecular weight of 426.43 g/mol. Its IUPAC name is 1-(3,5-dimethoxyphenyl)-3-[4-(3,4-dimethoxyphenyl)-3-oxopyrazin-2-yl]urea.
| Compound Name | 1-(3,5-dimethoxyphenyl)-3-[4-(3,4-dimethoxyphenyl)-3-oxopyrazin-2-yl]urea |
|---|---|
| PubChem CID | 53118349 |
| Molecular Formula | C21H22N4O6 |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | 1-(3,5-dimethoxyphenyl)-3-[4-(3,4-dimethoxyphenyl)-3-oxopyrazin-2-yl]urea |
| SMILES | COc1cc(NC(=O)Nc2nccn(-c3ccc(OC)c(OC)c3)c2=O)cc(OC)c1 |
| InChI | InChI=1S/C21H22N4O6/c1-28-15-9-13(10-16(12-15)29-2)23-21(27)24-19-20(26)25(8-7-22-19)14-5-6-17(30-3)18(11-14)31-4/h5-12H,1-4H3,(H2,22,23,24,27) |
| InChIKey | DZPFHPUCZNUZBF-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 112.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |