C18H16N4O4 — CID 53118521
N-[4-(3,4-dimethoxyphenyl)-3-oxopyrazin-2-yl]pyridine-4-carboxamide (PubChem CID 53118521) has the molecular formula C18H16N4O4 and a molecular weight of 352.35 g/mol. Its IUPAC name is N-[4-(3,4-dimethoxyphenyl)-3-oxopyrazin-2-yl]pyridine-4-carboxamide.
| Compound Name | N-[4-(3,4-dimethoxyphenyl)-3-oxopyrazin-2-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 53118521 |
| Molecular Formula | C18H16N4O4 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | N-[4-(3,4-dimethoxyphenyl)-3-oxopyrazin-2-yl]pyridine-4-carboxamide |
| SMILES | COc1ccc(-n2ccnc(NC(=O)c3ccncc3)c2=O)cc1OC |
| InChI | InChI=1S/C18H16N4O4/c1-25-14-4-3-13(11-15(14)26-2)22-10-9-20-16(18(22)24)21-17(23)12-5-7-19-8-6-12/h3-11H,1-2H3,(H,20,21,23) |
| InChIKey | FBERLAJRUFYMMZ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |