C18H20O4 — CID 69203269
5-[1-(3,5-dimethoxyphenyl)prop-1-enyl]-2-methoxyphenol (PubChem CID 69203269) has the molecular formula C18H20O4 and a molecular weight of 300.35 g/mol. Its IUPAC name is 5-[1-(3,5-dimethoxyphenyl)prop-1-enyl]-2-methoxyphenol.
| Compound Name | 5-[1-(3,5-dimethoxyphenyl)prop-1-enyl]-2-methoxyphenol |
|---|---|
| PubChem CID | 69203269 |
| Molecular Formula | C18H20O4 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 5-[1-(3,5-dimethoxyphenyl)prop-1-enyl]-2-methoxyphenol |
| SMILES | CC=C(c1cc(OC)cc(OC)c1)c1ccc(OC)c(O)c1 |
| InChI | InChI=1S/C18H20O4/c1-5-16(12-6-7-18(22-4)17(19)10-12)13-8-14(20-2)11-15(9-13)21-3/h5-11,19H,1-4H3 |
| InChIKey | MPUREEUXQTXPRX-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |