C24H29ClN2O5 — CID 11684035
[5-[(Z)-2-cyano-1-(3-ethoxy-4-methoxyphenyl)ethenyl]-2-methoxyphenyl] 2-amino-3-methylbutanoate;hydrochloride (PubChem CID 11684035) has the molecular formula C24H29ClN2O5 and a molecular weight of 460.96 g/mol. Its IUPAC name is [5-[(Z)-2-cyano-1-(3-ethoxy-4-methoxyphenyl)ethenyl]-2-methoxyphenyl] 2-amino-3-methylbutanoate;hydrochloride.
| Compound Name | [5-[(Z)-2-cyano-1-(3-ethoxy-4-methoxyphenyl)ethenyl]-2-methoxyphenyl] 2-amino-3-methylbutanoate;hydrochloride |
|---|---|
| PubChem CID | 11684035 |
| Molecular Formula | C24H29ClN2O5 |
| Molecular Weight | 460.96 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | [5-[(Z)-2-cyano-1-(3-ethoxy-4-methoxyphenyl)ethenyl]-2-methoxyphenyl] 2-amino-3-methylbutanoate;hydrochloride |
| SMILES | CCOc1cc(/C(=C/C#N)c2ccc(OC)c(OC(=O)C(N)C(C)C)c2)ccc1OC.Cl |
| InChI | InChI=1S/C24H28N2O5.ClH/c1-6-30-21-13-16(7-9-19(21)28-4)18(11-12-25)17-8-10-20(29-5)22(14-17)31-24(27)23(26)15(2)3;/h7-11,13-15,23H,6,26H2,1-5H3;1H/b18-11-; |
| InChIKey | VRNPKPWABMOJHS-VVTVMFAVSA-N |
| XLogP | 4.37 |
| TPSA | 103.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.96 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|