C27H27N3O5 — CID 70327166
1-[5-[(E)-2-cyano-1-(3-ethoxy-4-methoxyphenyl)ethenyl]-2-methoxyphenyl]-3-[hydroxy(phenyl)methyl]urea (PubChem CID 70327166) has the molecular formula C27H27N3O5 and a molecular weight of 473.53 g/mol. Its IUPAC name is 1-[5-[(E)-2-cyano-1-(3-ethoxy-4-methoxyphenyl)ethenyl]-2-methoxyphenyl]-3-[hydroxy(phenyl)methyl]urea.
| Compound Name | 1-[5-[(E)-2-cyano-1-(3-ethoxy-4-methoxyphenyl)ethenyl]-2-methoxyphenyl]-3-[hydroxy(phenyl)methyl]urea |
|---|---|
| PubChem CID | 70327166 |
| Molecular Formula | C27H27N3O5 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | 1-[5-[(E)-2-cyano-1-(3-ethoxy-4-methoxyphenyl)ethenyl]-2-methoxyphenyl]-3-[hydroxy(phenyl)methyl]urea |
| SMILES | CCOc1cc(/C(=C/C#N)c2ccc(OC)c(NC(=O)NC(O)c3ccccc3)c2)ccc1OC |
| InChI | InChI=1S/C27H27N3O5/c1-4-35-25-17-20(11-13-24(25)34-3)21(14-15-28)19-10-12-23(33-2)22(16-19)29-27(32)30-26(31)18-8-6-5-7-9-18/h5-14,16-17,26,31H,4H2,1-3H3,(H2,29,30,32)/b21-14+ |
| InChIKey | BLNCHAZMMSDSIO-KGENOOAVSA-N |
| XLogP | 4.87 |
| TPSA | 112.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|