C16H12FNO2S — CID 62698098
3-(1-benzothiophen-3-ylmethylamino)-4-fluorobenzoic acid (PubChem CID 62698098) has the molecular formula C16H12FNO2S and a molecular weight of 301.34 g/mol. Its IUPAC name is 3-(1-benzothiophen-3-ylmethylamino)-4-fluorobenzoic acid.
| Compound Name | 3-(1-benzothiophen-3-ylmethylamino)-4-fluorobenzoic acid |
|---|---|
| PubChem CID | 62698098 |
| Molecular Formula | C16H12FNO2S |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | 3-(1-benzothiophen-3-ylmethylamino)-4-fluorobenzoic acid |
| SMILES | O=C(O)c1ccc(F)c(NCc2csc3ccccc23)c1 |
| InChI | InChI=1S/C16H12FNO2S/c17-13-6-5-10(16(19)20)7-14(13)18-8-11-9-21-15-4-2-1-3-12(11)15/h1-7,9,18H,8H2,(H,19,20) |
| InChIKey | YRLZICRFWVNLJQ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |