C22H18Cl2N2OS — CID 46762705
N-[(2,4-dichlorophenyl)methylcarbamothioyl]-2,2-diphenylacetamide (PubChem CID 46762705) has the molecular formula C22H18Cl2N2OS and a molecular weight of 429.37 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methylcarbamothioyl]-2,2-diphenylacetamide.
| Compound Name | N-[(2,4-dichlorophenyl)methylcarbamothioyl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 46762705 |
| Molecular Formula | C22H18Cl2N2OS |
| Molecular Weight | 429.37 g/mol |
| Exact Mass | 428.05 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methylcarbamothioyl]-2,2-diphenylacetamide |
| SMILES | O=C(NC(=S)NCc1ccc(Cl)cc1Cl)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H18Cl2N2OS/c23-18-12-11-17(19(24)13-18)14-25-22(28)26-21(27)20(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-13,20H,14H2,(H2,25,26,27,28) |
| InChIKey | PVVITLMUMNRPSN-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.37 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|