C24H29ClN2O5S — CID 54785804
3-phenylpropyl 5-[(2-chloro-4,5-dimethoxyphenyl)methylcarbamothioylamino]-5-oxopentanoate (PubChem CID 54785804) has the molecular formula C24H29ClN2O5S and a molecular weight of 493.03 g/mol. Its IUPAC name is 3-phenylpropyl 5-[(2-chloro-4,5-dimethoxyphenyl)methylcarbamothioylamino]-5-oxopentanoate.
| Compound Name | 3-phenylpropyl 5-[(2-chloro-4,5-dimethoxyphenyl)methylcarbamothioylamino]-5-oxopentanoate |
|---|---|
| PubChem CID | 54785804 |
| Molecular Formula | C24H29ClN2O5S |
| Molecular Weight | 493.03 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | 3-phenylpropyl 5-[(2-chloro-4,5-dimethoxyphenyl)methylcarbamothioylamino]-5-oxopentanoate |
| SMILES | COc1cc(Cl)c(CNC(=S)NC(=O)CCCC(=O)OCCCc2ccccc2)cc1OC |
| InChI | InChI=1S/C24H29ClN2O5S/c1-30-20-14-18(19(25)15-21(20)31-2)16-26-24(33)27-22(28)11-6-12-23(29)32-13-7-10-17-8-4-3-5-9-17/h3-5,8-9,14-15H,6-7,10-13,16H2,1-2H3,(H2,26,27,28,33) |
| InChIKey | FOIYUTHSFHZREB-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.03 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|