C20H25N3O4 — CID 143491866
methyl 2-(4-aminophenoxy)-5-(pentan-3-ylcarbamoylamino)benzoate (PubChem CID 143491866) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is methyl 2-(4-aminophenoxy)-5-(pentan-3-ylcarbamoylamino)benzoate.
| Compound Name | methyl 2-(4-aminophenoxy)-5-(pentan-3-ylcarbamoylamino)benzoate |
|---|---|
| PubChem CID | 143491866 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | methyl 2-(4-aminophenoxy)-5-(pentan-3-ylcarbamoylamino)benzoate |
| SMILES | CCC(CC)NC(=O)Nc1ccc(Oc2ccc(N)cc2)c(C(=O)OC)c1 |
| InChI | InChI=1S/C20H25N3O4/c1-4-14(5-2)22-20(25)23-15-8-11-18(17(12-15)19(24)26-3)27-16-9-6-13(21)7-10-16/h6-12,14H,4-5,21H2,1-3H3,(H2,22,23,25) |
| InChIKey | XLDOGZUMGFBIJW-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|